C16H28 — CID 139591490
(1R,3aZ,6R,9aS)-1,4,6,8,8-pentamethyl-1,2,3,5,6,7,9,9a-octahydrocyclopenta[8]annulene (PubChem CID 139591490) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is (1R,3aZ,6R,9aS)-1,4,6,8,8-pentamethyl-1,2,3,5,6,7,9,9a-octahydrocyclopenta[8]annulene.
| Compound Name | (1R,3aZ,6R,9aS)-1,4,6,8,8-pentamethyl-1,2,3,5,6,7,9,9a-octahydrocyclopenta[8]annulene |
|---|---|
| PubChem CID | 139591490 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | (1R,3aZ,6R,9aS)-1,4,6,8,8-pentamethyl-1,2,3,5,6,7,9,9a-octahydrocyclopenta[8]annulene |
| SMILES | C/C1=C2\CC[C@@H](C)[C@@H]2CC(C)(C)C[C@@H](C)C1 |
| InChI | InChI=1S/C16H28/c1-11-8-13(3)14-7-6-12(2)15(14)10-16(4,5)9-11/h11-12,15H,6-10H2,1-5H3/b14-13-/t11-,12+,15-/m0/s1 |
| InChIKey | BYOMETGGPNQEIZ-BGRAMADLSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|