C12H20O4 — CID 139591533
(3S,5S)-5-[(E,3S,4R)-3,4-dihydroxyhept-1-enyl]-3-methyloxolan-2-one (PubChem CID 139591533) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is (3S,5S)-5-[(E,3S,4R)-3,4-dihydroxyhept-1-enyl]-3-methyloxolan-2-one.
| Compound Name | (3S,5S)-5-[(E,3S,4R)-3,4-dihydroxyhept-1-enyl]-3-methyloxolan-2-one |
|---|---|
| PubChem CID | 139591533 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (3S,5S)-5-[(E,3S,4R)-3,4-dihydroxyhept-1-enyl]-3-methyloxolan-2-one |
| SMILES | CCC[C@@H](O)[C@@H](O)/C=C/[C@@H]1C[C@H](C)C(=O)O1 |
| InChI | InChI=1S/C12H20O4/c1-3-4-10(13)11(14)6-5-9-7-8(2)12(15)16-9/h5-6,8-11,13-14H,3-4,7H2,1-2H3/b6-5+/t8-,9+,10+,11-/m0/s1 |
| InChIKey | YSBXVJRSDSTXTB-BOOWNLRVSA-N |
| XLogP | 1.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|