C15H24O2 — CID 139591589
(2E,6R,7E,9S)-6-(2-hydroxypropan-2-yl)-3,9-dimethylcyclodeca-2,7-dien-1-one (PubChem CID 139591589) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (2E,6R,7E,9S)-6-(2-hydroxypropan-2-yl)-3,9-dimethylcyclodeca-2,7-dien-1-one.
| Compound Name | (2E,6R,7E,9S)-6-(2-hydroxypropan-2-yl)-3,9-dimethylcyclodeca-2,7-dien-1-one |
|---|---|
| PubChem CID | 139591589 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (2E,6R,7E,9S)-6-(2-hydroxypropan-2-yl)-3,9-dimethylcyclodeca-2,7-dien-1-one |
| SMILES | C/C1=C\C(=O)C[C@H](C)/C=C/[C@H](C(C)(C)O)CC1 |
| InChI | InChI=1S/C15H24O2/c1-11-5-7-13(15(3,4)17)8-6-12(2)10-14(16)9-11/h5,7,10-11,13,17H,6,8-9H2,1-4H3/b7-5+,12-10+/t11-,13+/m1/s1 |
| InChIKey | NRZAKJLNYYCGMN-HQQDGWKISA-N |
| XLogP | 3.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|