C17H24O6 — CID 139591613
(7R,8S)-4,8-dihydroxy-7-[(E,4S,5S)-5-hydroxy-4-methylhex-2-en-2-yl]-3,8-dimethyl-5,7-dihydropyrano[4,3-b]pyran-2-one (PubChem CID 139591613) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is (7R,8S)-4,8-dihydroxy-7-[(E,4S,5S)-5-hydroxy-4-methylhex-2-en-2-yl]-3,8-dimethyl-5,7-dihydropyrano[4,3-b]pyran-2-one.
| Compound Name | (7R,8S)-4,8-dihydroxy-7-[(E,4S,5S)-5-hydroxy-4-methylhex-2-en-2-yl]-3,8-dimethyl-5,7-dihydropyrano[4,3-b]pyran-2-one |
|---|---|
| PubChem CID | 139591613 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (7R,8S)-4,8-dihydroxy-7-[(E,4S,5S)-5-hydroxy-4-methylhex-2-en-2-yl]-3,8-dimethyl-5,7-dihydropyrano[4,3-b]pyran-2-one |
| SMILES | C/C(=C\[C@H](C)[C@H](C)O)[C@H]1OCc2c(oc(=O)c(C)c2O)[C@@]1(C)O |
| InChI | InChI=1S/C17H24O6/c1-8(11(4)18)6-9(2)14-17(5,21)15-12(7-22-14)13(19)10(3)16(20)23-15/h6,8,11,14,18-19,21H,7H2,1-5H3/b9-6+/t8-,11-,14+,17-/m0/s1 |
| InChIKey | YPVPXINVSPPRIQ-XRKQRGLRSA-N |
| XLogP | 1.72 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|