About (E)-7,8-dihydroxyoct-5-en-2-one
(E)-7,8-dihydroxyoct-5-en-2-one (PubChem CID 139591690) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is (E)-7,8-dihydroxyoct-5-en-2-one.
Molecular Properties
| Compound Name | (E)-7,8-dihydroxyoct-5-en-2-one |
| PubChem CID | 139591690 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (E)-7,8-dihydroxyoct-5-en-2-one |
| SMILES | CC(=O)CC/C=C/C(O)CO |
| InChI | InChI=1S/C8H14O3/c1-7(10)4-2-3-5-8(11)6-9/h3,5,8-9,11H,2,4,6H2,1H3/b5-3+ |
| InChIKey | FJIXUFNGODJNCX-HWKANZROSA-N |
| XLogP | 0.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-7,8-dihydroxyoct-5-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-7,8-dihydroxyoct-5-en-2-one?
The IUPAC name of (E)-7,8-dihydroxyoct-5-en-2-one (CID 139591690) is (E)-7,8-dihydroxyoct-5-en-2-one.
What is the SMILES notation for (E)-7,8-dihydroxyoct-5-en-2-one?
The canonical SMILES for (E)-7,8-dihydroxyoct-5-en-2-one is CC(=O)CC/C=C/C(O)CO.
What is the InChIKey of (E)-7,8-dihydroxyoct-5-en-2-one?
The InChIKey is FJIXUFNGODJNCX-HWKANZROSA-N. The full InChI is InChI=1S/C8H14O3/c1-7(10)4-2-3-5-8(11)6-9/h3,5,8-9,11H,2,4,6H2,1H3/b5-3+.
What are the key properties of (E)-7,8-dihydroxyoct-5-en-2-one?
(E)-7,8-dihydroxyoct-5-en-2-one has a molecular weight of 158.20 g/mol, XLogP of 0.26, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-7,8-dihydroxyoct-5-en-2-one is sourced from PubChem (CID 139591690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).