C8H14O3 — CID 139591691
(2E,4E)-octa-2,4-diene-1,6,7-triol (PubChem CID 139591691) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is (2E,4E)-octa-2,4-diene-1,6,7-triol.
| Compound Name | (2E,4E)-octa-2,4-diene-1,6,7-triol |
|---|---|
| PubChem CID | 139591691 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (2E,4E)-octa-2,4-diene-1,6,7-triol |
| SMILES | CC(O)C(O)/C=C/C=C/CO |
| InChI | InChI=1S/C8H14O3/c1-7(10)8(11)5-3-2-4-6-9/h2-5,7-11H,6H2,1H3/b4-2+,5-3+ |
| InChIKey | LSPIBEIDSFWFRY-ZUVMSYQZSA-N |
| XLogP | -0.17 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|