About (3R)-1-[6-(2,5-dioxopyrrolidin-1-yl)hexyl]-3-sulfanylpyrrolidine-2,5-dione
(3R)-1-[6-(2,5-dioxopyrrolidin-1-yl)hexyl]-3-sulfanylpyrrolidine-2,5-dione (PubChem CID 139592407) has the molecular formula C14H20N2O4S
and a molecular weight of 312.39 g/mol. Its IUPAC name is (3R)-1-[6-(2,5-dioxopyrrolidin-1-yl)hexyl]-3-sulfanylpyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | (3R)-1-[6-(2,5-dioxopyrrolidin-1-yl)hexyl]-3-sulfanylpyrrolidine-2,5-dione |
| PubChem CID | 139592407 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (3R)-1-[6-(2,5-dioxopyrrolidin-1-yl)hexyl]-3-sulfanylpyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1CCCCCCN1C(=O)C[C@@H](S)C1=O |
| InChI | InChI=1S/C14H20N2O4S/c17-11-5-6-12(18)15(11)7-3-1-2-4-8-16-13(19)9-10(21)14(16)20/h10,21H,1-9H2/t10-/m1/s1 |
| InChIKey | ATNPTWCRBYBRIP-SNVBAGLBSA-N |
| XLogP | 0.75 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3R)-1-[6-(2,5-dioxopyrrolidin-1-yl)hexyl]-3-sulfanylpyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-[6-(2,5-dioxopyrrolidin-1-yl)hexyl]-3-sulfanylpyrrolidine-2,5-dione?
The IUPAC name of (3R)-1-[6-(2,5-dioxopyrrolidin-1-yl)hexyl]-3-sulfanylpyrrolidine-2,5-dione (CID 139592407) is (3R)-1-[6-(2,5-dioxopyrrolidin-1-yl)hexyl]-3-sulfanylpyrrolidine-2,5-dione.
What is the SMILES notation for (3R)-1-[6-(2,5-dioxopyrrolidin-1-yl)hexyl]-3-sulfanylpyrrolidine-2,5-dione?
The canonical SMILES for (3R)-1-[6-(2,5-dioxopyrrolidin-1-yl)hexyl]-3-sulfanylpyrrolidine-2,5-dione is O=C1CCC(=O)N1CCCCCCN1C(=O)C[C@@H](S)C1=O.
What is the InChIKey of (3R)-1-[6-(2,5-dioxopyrrolidin-1-yl)hexyl]-3-sulfanylpyrrolidine-2,5-dione?
The InChIKey is ATNPTWCRBYBRIP-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H20N2O4S/c17-11-5-6-12(18)15(11)7-3-1-2-4-8-16-13(19)9-10(21)14(16)20/h10,21H,1-9H2/t10-/m1/s1.
What are the key properties of (3R)-1-[6-(2,5-dioxopyrrolidin-1-yl)hexyl]-3-sulfanylpyrrolidine-2,5-dione?
(3R)-1-[6-(2,5-dioxopyrrolidin-1-yl)hexyl]-3-sulfanylpyrrolidine-2,5-dione has a molecular weight of 312.39 g/mol, XLogP of 0.75, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-[6-(2,5-dioxopyrrolidin-1-yl)hexyl]-3-sulfanylpyrrolidine-2,5-dione is sourced from PubChem (CID 139592407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).