About 4-[6,7-dimethoxy-2-(4-methylpiperazin-1-yl)quinazolin-4-yl]morpholine
4-[6,7-dimethoxy-2-(4-methylpiperazin-1-yl)quinazolin-4-yl]morpholine (PubChem CID 139592902) has the molecular formula C19H27N5O3
and a molecular weight of 373.46 g/mol. Its IUPAC name is 4-[6,7-dimethoxy-2-(4-methylpiperazin-1-yl)quinazolin-4-yl]morpholine.
Molecular Properties
| Compound Name | 4-[6,7-dimethoxy-2-(4-methylpiperazin-1-yl)quinazolin-4-yl]morpholine |
| PubChem CID | 139592902 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 4-[6,7-dimethoxy-2-(4-methylpiperazin-1-yl)quinazolin-4-yl]morpholine |
| SMILES | COc1cc2nc(N3CCN(C)CC3)nc(N3CCOCC3)c2cc1OC |
| InChI | InChI=1S/C19H27N5O3/c1-22-4-6-24(7-5-22)19-20-15-13-17(26-3)16(25-2)12-14(15)18(21-19)23-8-10-27-11-9-23/h12-13H,4-11H2,1-3H3 |
| InChIKey | PNJHFISSUNQFLX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-[6,7-dimethoxy-2-(4-methylpiperazin-1-yl)quinazolin-4-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6,7-dimethoxy-2-(4-methylpiperazin-1-yl)quinazolin-4-yl]morpholine?
The IUPAC name of 4-[6,7-dimethoxy-2-(4-methylpiperazin-1-yl)quinazolin-4-yl]morpholine (CID 139592902) is 4-[6,7-dimethoxy-2-(4-methylpiperazin-1-yl)quinazolin-4-yl]morpholine.
What is the SMILES notation for 4-[6,7-dimethoxy-2-(4-methylpiperazin-1-yl)quinazolin-4-yl]morpholine?
The canonical SMILES for 4-[6,7-dimethoxy-2-(4-methylpiperazin-1-yl)quinazolin-4-yl]morpholine is COc1cc2nc(N3CCN(C)CC3)nc(N3CCOCC3)c2cc1OC.
What is the InChIKey of 4-[6,7-dimethoxy-2-(4-methylpiperazin-1-yl)quinazolin-4-yl]morpholine?
The InChIKey is PNJHFISSUNQFLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N5O3/c1-22-4-6-24(7-5-22)19-20-15-13-17(26-3)16(25-2)12-14(15)18(21-19)23-8-10-27-11-9-23/h12-13H,4-11H2,1-3H3.
What are the key properties of 4-[6,7-dimethoxy-2-(4-methylpiperazin-1-yl)quinazolin-4-yl]morpholine?
4-[6,7-dimethoxy-2-(4-methylpiperazin-1-yl)quinazolin-4-yl]morpholine has a molecular weight of 373.46 g/mol, XLogP of 1.24, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6,7-dimethoxy-2-(4-methylpiperazin-1-yl)quinazolin-4-yl]morpholine is sourced from PubChem (CID 139592902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).