About 1H-benzimidazol-3-ium;4-carboxyphenolate
1H-benzimidazol-3-ium;4-carboxyphenolate (PubChem CID 139592982) has the molecular formula C14H12N2O3
and a molecular weight of 256.26 g/mol. Its IUPAC name is 1H-benzimidazol-3-ium;4-carboxyphenolate.
Molecular Properties
| Compound Name | 1H-benzimidazol-3-ium;4-carboxyphenolate |
| PubChem CID | 139592982 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 1H-benzimidazol-3-ium;4-carboxyphenolate |
| SMILES | O=C(O)c1ccc([O-])cc1.c1ccc2[nH+]c[nH]c2c1 |
| InChI | InChI=1S/C7H6N2.C7H6O3/c1-2-4-7-6(3-1)8-5-9-7;8-6-3-1-5(2-4-6)7(9)10/h1-5H,(H,8,9);1-4,8H,(H,9,10) |
| InChIKey | NZJBHAQQRFQISA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-benzimidazol-3-ium;4-carboxyphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazol-3-ium;4-carboxyphenolate?
The IUPAC name of 1H-benzimidazol-3-ium;4-carboxyphenolate (CID 139592982) is 1H-benzimidazol-3-ium;4-carboxyphenolate.
What is the SMILES notation for 1H-benzimidazol-3-ium;4-carboxyphenolate?
The canonical SMILES for 1H-benzimidazol-3-ium;4-carboxyphenolate is O=C(O)c1ccc([O-])cc1.c1ccc2[nH+]c[nH]c2c1.
What is the InChIKey of 1H-benzimidazol-3-ium;4-carboxyphenolate?
The InChIKey is NZJBHAQQRFQISA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C7H6O3/c1-2-4-7-6(3-1)8-5-9-7;8-6-3-1-5(2-4-6)7(9)10/h1-5H,(H,8,9);1-4,8H,(H,9,10).
What are the key properties of 1H-benzimidazol-3-ium;4-carboxyphenolate?
1H-benzimidazol-3-ium;4-carboxyphenolate has a molecular weight of 256.26 g/mol, XLogP of 1.44, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazol-3-ium;4-carboxyphenolate is sourced from PubChem (CID 139592982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).