C21H22BrN3O — CID 139593034
6-bromo-1-cyclopentyl-N-(1-phenylethyl)indazole-4-carboxamide (PubChem CID 139593034) has the molecular formula C21H22BrN3O and a molecular weight of 412.33 g/mol. Its IUPAC name is 6-bromo-1-cyclopentyl-N-(1-phenylethyl)indazole-4-carboxamide.
| Compound Name | 6-bromo-1-cyclopentyl-N-(1-phenylethyl)indazole-4-carboxamide |
|---|---|
| PubChem CID | 139593034 |
| Molecular Formula | C21H22BrN3O |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 6-bromo-1-cyclopentyl-N-(1-phenylethyl)indazole-4-carboxamide |
| SMILES | CC(NC(=O)c1cc(Br)cc2c1cnn2C1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C21H22BrN3O/c1-14(15-7-3-2-4-8-15)24-21(26)18-11-16(22)12-20-19(18)13-23-25(20)17-9-5-6-10-17/h2-4,7-8,11-14,17H,5-6,9-10H2,1H3,(H,24,26) |
| InChIKey | KLOLWFRBQXLGHD-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |