C8HF19O2S — CID 139594170
2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-8-(pentafluoro-λ6-sulfanyl)octanoic acid (PubChem CID 139594170) has the molecular formula C8HF19O2S and a molecular weight of 522.12 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-8-(pentafluoro-λ6-sulfanyl)octanoic acid.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-8-(pentafluoro-λ6-sulfanyl)octanoic acid |
|---|---|
| PubChem CID | 139594170 |
| Molecular Formula | C8HF19O2S |
| Molecular Weight | 522.12 g/mol |
| Exact Mass | 521.94 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-8-(pentafluoro-λ6-sulfanyl)octanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(F)(F)(F)(F)F |
| InChI | InChI=1S/C8HF19O2S/c9-2(10,1(28)29)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)30(23,24,25,26)27/h(H,28,29) |
| InChIKey | AJBZTNALOBRIRR-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.12 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|