C24H21F27Sn — CID 139594255
[1,1,1,2,2,3,3,4,4,14,14,15,15,16,16,17,17,17-octadecafluoro-10-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)heptadec-9-en-8-yl]-λ2-stannane (PubChem CID 139594255) has the molecular formula C24H21F27Sn and a molecular weight of 941.09 g/mol. Its IUPAC name is [1,1,1,2,2,3,3,4,4,14,14,15,15,16,16,17,17,17-octadecafluoro-10-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)heptadec-9-en-8-yl]-λ2-stannane.
| Compound Name | [1,1,1,2,2,3,3,4,4,14,14,15,15,16,16,17,17,17-octadecafluoro-10-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)heptadec-9-en-8-yl]-λ2-stannane |
|---|---|
| PubChem CID | 139594255 |
| Molecular Formula | C24H21F27Sn |
| Molecular Weight | 941.09 g/mol |
| Exact Mass | 942.02 |
| IUPAC Name | [1,1,1,2,2,3,3,4,4,14,14,15,15,16,16,17,17,17-octadecafluoro-10-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)heptadec-9-en-8-yl]-λ2-stannane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCC(=CC([SnH])CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H20F27.Sn.H/c25-13(26,16(31,32)19(37,38)22(43,44)45)9-3-1-2-6-12(7-4-10-14(27,28)17(33,34)20(39,40)23(46,47)48)8-5-11-15(29,30)18(35,36)21(41,42)24(49,50)51;;/h2,6H,1,3-5,7-11H2;; |
| InChIKey | AWXKBZBNZBUKHW-UHFFFAOYSA-N |
| XLogP | 12.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.09 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|