About sodium;2-aminoethanol;3H-1,3-benzothiazole-2-thione
sodium;2-aminoethanol;3H-1,3-benzothiazole-2-thione (PubChem CID 139594286) has the molecular formula C9H12N2NaOS2+
and a molecular weight of 251.33 g/mol. Its IUPAC name is sodium;2-aminoethanol;3H-1,3-benzothiazole-2-thione.
Molecular Properties
| Compound Name | sodium;2-aminoethanol;3H-1,3-benzothiazole-2-thione |
| PubChem CID | 139594286 |
| Molecular Formula | C9H12N2NaOS2+ |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | sodium;2-aminoethanol;3H-1,3-benzothiazole-2-thione |
| SMILES | NCCO.S=c1[nH]c2ccccc2s1.[Na+] |
| InChI | InChI=1S/C7H5NS2.C2H7NO.Na/c9-7-8-5-3-1-2-4-6(5)10-7;3-1-2-4;/h1-4H,(H,8,9);4H,1-3H2;/q;;+1 |
| InChIKey | BAPFZFPIHZFJMA-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-aminoethanol;3H-1,3-benzothiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-aminoethanol;3H-1,3-benzothiazole-2-thione?
The IUPAC name of sodium;2-aminoethanol;3H-1,3-benzothiazole-2-thione (CID 139594286) is sodium;2-aminoethanol;3H-1,3-benzothiazole-2-thione.
What is the SMILES notation for sodium;2-aminoethanol;3H-1,3-benzothiazole-2-thione?
The canonical SMILES for sodium;2-aminoethanol;3H-1,3-benzothiazole-2-thione is NCCO.S=c1[nH]c2ccccc2s1.[Na+].
What is the InChIKey of sodium;2-aminoethanol;3H-1,3-benzothiazole-2-thione?
The InChIKey is BAPFZFPIHZFJMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS2.C2H7NO.Na/c9-7-8-5-3-1-2-4-6(5)10-7;3-1-2-4;/h1-4H,(H,8,9);4H,1-3H2;/q;;+1.
What are the key properties of sodium;2-aminoethanol;3H-1,3-benzothiazole-2-thione?
sodium;2-aminoethanol;3H-1,3-benzothiazole-2-thione has a molecular weight of 251.33 g/mol, XLogP of -1.10, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-aminoethanol;3H-1,3-benzothiazole-2-thione is sourced from PubChem (CID 139594286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).