C21H32O5S — CID 139594408
5-(4-hexyl-6-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl)pentanoic acid (PubChem CID 139594408) has the molecular formula C21H32O5S and a molecular weight of 396.55 g/mol. Its IUPAC name is 5-(4-hexyl-6-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl)pentanoic acid.
| Compound Name | 5-(4-hexyl-6-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 139594408 |
| Molecular Formula | C21H32O5S |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 5-(4-hexyl-6-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl)pentanoic acid |
| SMILES | CCCCCCC1CCC(CCCCC(=O)O)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C21H32O5S/c1-2-3-4-5-8-17-12-11-16(9-6-7-10-21(22)23)19-14-13-18(15-20(17)19)27(24,25)26/h13-17H,2-12H2,1H3,(H,22,23)(H,24,25,26) |
| InChIKey | BRDFAMGDNFULLL-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|