C41H59N5O8 — CID 139594454
5-[bis(2-ethoxy-2-oxoethyl)carbamoyloxy]-2-(4-tert-butylphenyl)-6-cyano-2-(2,2-ditert-butyl-5-methylcyclohexyl)-1,3-dihydropyrrolo[1,2-b][1,2,4]triazole-7-carboxylic acid (PubChem CID 139594454) has the molecular formula C41H59N5O8 and a molecular weight of 749.95 g/mol. Its IUPAC name is 5-[bis(2-ethoxy-2-oxoethyl)carbamoyloxy]-2-(4-tert-butylphenyl)-6-cyano-2-(2,2-ditert-butyl-5-methylcyclohexyl)-1,3-dihydropyrrolo[1,2-b][1,2,4]triazole-7-carboxylic acid.
| Compound Name | 5-[bis(2-ethoxy-2-oxoethyl)carbamoyloxy]-2-(4-tert-butylphenyl)-6-cyano-2-(2,2-ditert-butyl-5-methylcyclohexyl)-1,3-dihydropyrrolo[1,2-b][1,2,4]triazole-7-carboxylic acid |
|---|---|
| PubChem CID | 139594454 |
| Molecular Formula | C41H59N5O8 |
| Molecular Weight | 749.95 g/mol |
| Exact Mass | 749.44 |
| IUPAC Name | 5-[bis(2-ethoxy-2-oxoethyl)carbamoyloxy]-2-(4-tert-butylphenyl)-6-cyano-2-(2,2-ditert-butyl-5-methylcyclohexyl)-1,3-dihydropyrrolo[1,2-b][1,2,4]triazole-7-carboxylic acid |
| SMILES | CCOC(=O)CN(CC(=O)OCC)C(=O)Oc1c(C#N)c(C(=O)O)c2n1NC(c1ccc(C(C)(C)C)cc1)(C1CC(C)CCC1(C(C)(C)C)C(C)(C)C)N2 |
| InChI | InChI=1S/C41H59N5O8/c1-13-52-30(47)23-45(24-31(48)53-14-2)36(51)54-34-28(22-42)32(35(49)50)33-43-41(44-46(33)34,27-17-15-26(16-18-27)37(4,5)6)29-21-25(3)19-20-40(29,38(7,8)9)39(10,11)12/h15-18,25,29,43-44H,13-14,19-21,23-24H2,1-12H3,(H,49,50) |
| InChIKey | BYLFDXMFLKOKHK-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 172.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.95 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |