C15H14N3O2+ — CID 139594466
(1R,12S)-14-acetyl-5,8-diaza-14-azoniatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaen-13-one (PubChem CID 139594466) has the molecular formula C15H14N3O2+ and a molecular weight of 268.30 g/mol. Its IUPAC name is (1R,12S)-14-acetyl-5,8-diaza-14-azoniatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaen-13-one.
| Compound Name | (1R,12S)-14-acetyl-5,8-diaza-14-azoniatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaen-13-one |
|---|---|
| PubChem CID | 139594466 |
| Molecular Formula | C15H14N3O2+ |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (1R,12S)-14-acetyl-5,8-diaza-14-azoniatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaen-13-one |
| SMILES | CC(=O)[NH+]1C[C@@H]2C[C@H](C1=O)c1cc3nccnc3cc12 |
| InChI | InChI=1S/C15H13N3O2/c1-8(19)18-7-9-4-12(15(18)20)11-6-14-13(5-10(9)11)16-2-3-17-14/h2-3,5-6,9,12H,4,7H2,1H3/p+1/t9-,12-/m0/s1 |
| InChIKey | BZRVFZBUNOCANR-CABZTGNLSA-O |
| XLogP | 0.17 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |