C7H5F11O4S — CID 139594501
3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-hydroxyheptane-1-sulfonic acid (PubChem CID 139594501) has the molecular formula C7H5F11O4S and a molecular weight of 394.16 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-hydroxyheptane-1-sulfonic acid.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-hydroxyheptane-1-sulfonic acid |
|---|---|
| PubChem CID | 139594501 |
| Molecular Formula | C7H5F11O4S |
| Molecular Weight | 394.16 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-hydroxyheptane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H5F11O4S/c8-3(9,1-2(19)23(20,21)22)4(10,11)5(12,13)6(14,15)7(16,17)18/h2,19H,1H2,(H,20,21,22) |
| InChIKey | CDZUVFCZDWZHHN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.16 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|