C17H31N3O — CID 139594573
(13S,17R)-17-propyl-1,5,10-triazabicyclo[11.4.0]heptadec-14-en-11-one (PubChem CID 139594573) has the molecular formula C17H31N3O and a molecular weight of 293.46 g/mol. Its IUPAC name is (13S,17R)-17-propyl-1,5,10-triazabicyclo[11.4.0]heptadec-14-en-11-one.
| Compound Name | (13S,17R)-17-propyl-1,5,10-triazabicyclo[11.4.0]heptadec-14-en-11-one |
|---|---|
| PubChem CID | 139594573 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | (13S,17R)-17-propyl-1,5,10-triazabicyclo[11.4.0]heptadec-14-en-11-one |
| SMILES | CCC[C@@H]1CC=C[C@@H]2CC(=O)NCCCCNCCCN12 |
| InChI | InChI=1S/C17H31N3O/c1-2-7-15-8-5-9-16-14-17(21)19-12-4-3-10-18-11-6-13-20(15)16/h5,9,15-16,18H,2-4,6-8,10-14H2,1H3,(H,19,21)/t15-,16-/m1/s1 |
| InChIKey | CNKJXFDDDAFHPG-HZPDHXFCSA-N |
| XLogP | 2.07 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|