C14H17NO5 — CID 139594652
3-(3,4-diethoxyphenyl)-5-methyl-1,3-oxazolidine-2,4-dione (PubChem CID 139594652) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is 3-(3,4-diethoxyphenyl)-5-methyl-1,3-oxazolidine-2,4-dione.
| Compound Name | 3-(3,4-diethoxyphenyl)-5-methyl-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 139594652 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 3-(3,4-diethoxyphenyl)-5-methyl-1,3-oxazolidine-2,4-dione |
| SMILES | CCOc1ccc(N2C(=O)OC(C)C2=O)cc1OCC |
| InChI | InChI=1S/C14H17NO5/c1-4-18-11-7-6-10(8-12(11)19-5-2)15-13(16)9(3)20-14(15)17/h6-9H,4-5H2,1-3H3 |
| InChIKey | CYUKLOPUJKXNNS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |