C15H18F17N2O2S+ — CID 139594654
3-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl(methyl)amino]propyl-trimethylazanium (PubChem CID 139594654) has the molecular formula C15H18F17N2O2S+ and a molecular weight of 613.35 g/mol. Its IUPAC name is 3-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl(methyl)amino]propyl-trimethylazanium.
| Compound Name | 3-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl(methyl)amino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 139594654 |
| Molecular Formula | C15H18F17N2O2S+ |
| Molecular Weight | 613.35 g/mol |
| Exact Mass | 613.08 |
| IUPAC Name | 3-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl(methyl)amino]propyl-trimethylazanium |
| SMILES | CN(CCC[N+](C)(C)C)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H18F17N2O2S/c1-33(6-5-7-34(2,3)4)37(35,36)15(31,32)13(26,27)11(22,23)9(18,19)8(16,17)10(20,21)12(24,25)14(28,29)30/h5-7H2,1-4H3/q+1 |
| InChIKey | CZLOVMCKXAUUND-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.35 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|