C14H16O7S — CID 139594734
2-[4-(carboxymethyl)-6-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl]acetic acid (PubChem CID 139594734) has the molecular formula C14H16O7S and a molecular weight of 328.34 g/mol. Its IUPAC name is 2-[4-(carboxymethyl)-6-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl]acetic acid.
| Compound Name | 2-[4-(carboxymethyl)-6-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl]acetic acid |
|---|---|
| PubChem CID | 139594734 |
| Molecular Formula | C14H16O7S |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 2-[4-(carboxymethyl)-6-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl]acetic acid |
| SMILES | O=C(O)CC1CCC(CC(=O)O)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C14H16O7S/c15-13(16)5-8-1-2-9(6-14(17)18)12-7-10(22(19,20)21)3-4-11(8)12/h3-4,7-9H,1-2,5-6H2,(H,15,16)(H,17,18)(H,19,20,21) |
| InChIKey | DJKOSZSOIYIRRS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|