C13H20F11N2O5S2+ — CID 139594754
dimethyl-(3-sulfopropyl)-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azanium (PubChem CID 139594754) has the molecular formula C13H20F11N2O5S2+ and a molecular weight of 557.42 g/mol. Its IUPAC name is dimethyl-(3-sulfopropyl)-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azanium.
| Compound Name | dimethyl-(3-sulfopropyl)-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azanium |
|---|---|
| PubChem CID | 139594754 |
| Molecular Formula | C13H20F11N2O5S2+ |
| Molecular Weight | 557.42 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | dimethyl-(3-sulfopropyl)-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azanium |
| SMILES | C[N+](C)(CCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCS(=O)(=O)O |
| InChI | InChI=1S/C13H19F11N2O5S2/c1-26(2,7-4-8-32(27,28)29)6-3-5-25-33(30,31)13(23,24)11(18,19)9(14,15)10(16,17)12(20,21)22/h25H,3-8H2,1-2H3/p+1 |
| InChIKey | DNQQNHMQRHDWLQ-UHFFFAOYSA-O |
| XLogP | 2.71 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|