C15H18O7S — CID 139594807
3-[4-(carboxymethyl)-7-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl]propanoic acid (PubChem CID 139594807) has the molecular formula C15H18O7S and a molecular weight of 342.37 g/mol. Its IUPAC name is 3-[4-(carboxymethyl)-7-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl]propanoic acid.
| Compound Name | 3-[4-(carboxymethyl)-7-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl]propanoic acid |
|---|---|
| PubChem CID | 139594807 |
| Molecular Formula | C15H18O7S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 3-[4-(carboxymethyl)-7-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl]propanoic acid |
| SMILES | O=C(O)CCC1CCC(CC(=O)O)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C15H18O7S/c16-14(17)6-3-9-1-2-10(7-15(18)19)12-5-4-11(8-13(9)12)23(20,21)22/h4-5,8-10H,1-3,6-7H2,(H,16,17)(H,18,19)(H,20,21,22) |
| InChIKey | DTPSWYPGRJLURN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|