C16H26F11N2O8S3+ — CID 139594861
dimethyl-(3-sulfopropyl)-[3-[3-sulfopropyl(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyl)amino]propyl]azanium (PubChem CID 139594861) has the molecular formula C16H26F11N2O8S3+ and a molecular weight of 679.57 g/mol. Its IUPAC name is dimethyl-(3-sulfopropyl)-[3-[3-sulfopropyl(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyl)amino]propyl]azanium.
| Compound Name | dimethyl-(3-sulfopropyl)-[3-[3-sulfopropyl(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyl)amino]propyl]azanium |
|---|---|
| PubChem CID | 139594861 |
| Molecular Formula | C16H26F11N2O8S3+ |
| Molecular Weight | 679.57 g/mol |
| Exact Mass | 679.07 |
| IUPAC Name | dimethyl-(3-sulfopropyl)-[3-[3-sulfopropyl(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyl)amino]propyl]azanium |
| SMILES | C[N+](C)(CCCN(CCCS(=O)(=O)O)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCS(=O)(=O)O |
| InChI | InChI=1S/C16H25F11N2O8S3/c1-29(2,9-5-11-39(33,34)35)8-3-6-28(7-4-10-38(30,31)32)40(36,37)16(26,27)14(21,22)12(17,18)13(19,20)15(23,24)25/h3-11H2,1-2H3,(H-,30,31,32,33,34,35)/p+1 |
| InChIKey | FCYIOXJRCMYMIW-UHFFFAOYSA-O |
| XLogP | 2.70 |
| TPSA | 146.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|