C19H26F17N2O8S3+ — CID 139594895
3-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl(3-sulfopropyl)amino]propyl-dimethyl-(3-sulfopropyl)azanium (PubChem CID 139594895) has the molecular formula C19H26F17N2O8S3+ and a molecular weight of 829.59 g/mol. Its IUPAC name is 3-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl(3-sulfopropyl)amino]propyl-dimethyl-(3-sulfopropyl)azanium.
| Compound Name | 3-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl(3-sulfopropyl)amino]propyl-dimethyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 139594895 |
| Molecular Formula | C19H26F17N2O8S3+ |
| Molecular Weight | 829.59 g/mol |
| Exact Mass | 829.06 |
| IUPAC Name | 3-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl(3-sulfopropyl)amino]propyl-dimethyl-(3-sulfopropyl)azanium |
| SMILES | C[N+](C)(CCCN(CCCS(=O)(=O)O)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCS(=O)(=O)O |
| InChI | InChI=1S/C19H25F17N2O8S3/c1-38(2,9-5-11-48(42,43)44)8-3-6-37(7-4-10-47(39,40)41)49(45,46)19(35,36)17(30,31)15(26,27)13(22,23)12(20,21)14(24,25)16(28,29)18(32,33)34/h3-11H2,1-2H3,(H-,39,40,41,42,43,44)/p+1 |
| InChIKey | FHWPTNWVEZCJTE-UHFFFAOYSA-O |
| XLogP | 4.61 |
| TPSA | 146.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|