C14H22F11N2O5S2+ — CID 139594930
dimethyl-[3-[methyl(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyl)amino]propyl]-(3-sulfopropyl)azanium (PubChem CID 139594930) has the molecular formula C14H22F11N2O5S2+ and a molecular weight of 571.45 g/mol. Its IUPAC name is dimethyl-[3-[methyl(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyl)amino]propyl]-(3-sulfopropyl)azanium.
| Compound Name | dimethyl-[3-[methyl(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyl)amino]propyl]-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 139594930 |
| Molecular Formula | C14H22F11N2O5S2+ |
| Molecular Weight | 571.45 g/mol |
| Exact Mass | 571.08 |
| IUPAC Name | dimethyl-[3-[methyl(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyl)amino]propyl]-(3-sulfopropyl)azanium |
| SMILES | CN(CCC[N+](C)(C)CCCS(=O)(=O)O)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H21F11N2O5S2/c1-26(6-4-7-27(2,3)8-5-9-33(28,29)30)34(31,32)14(24,25)12(19,20)10(15,16)11(17,18)13(21,22)23/h4-9H2,1-3H3/p+1 |
| InChIKey | FLZXDOGZXYXNOM-UHFFFAOYSA-O |
| XLogP | 3.05 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|