C23H36O5S — CID 139594970
7-(4-hexyl-6-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl)heptanoic acid (PubChem CID 139594970) has the molecular formula C23H36O5S and a molecular weight of 424.60 g/mol. Its IUPAC name is 7-(4-hexyl-6-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl)heptanoic acid.
| Compound Name | 7-(4-hexyl-6-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl)heptanoic acid |
|---|---|
| PubChem CID | 139594970 |
| Molecular Formula | C23H36O5S |
| Molecular Weight | 424.60 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 7-(4-hexyl-6-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl)heptanoic acid |
| SMILES | CCCCCCC1CCC(CCCCCCC(=O)O)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C23H36O5S/c1-2-3-4-7-11-19-14-13-18(10-8-5-6-9-12-23(24)25)21-16-15-20(17-22(19)21)29(26,27)28/h15-19H,2-14H2,1H3,(H,24,25)(H,26,27,28) |
| InChIKey | FTIHSSALIIRLBS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.60 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|