C12H18F11N2O2S+ — CID 139595257
trimethyl-[3-[methyl(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyl)amino]propyl]azanium (PubChem CID 139595257) has the molecular formula C12H18F11N2O2S+ and a molecular weight of 463.33 g/mol. Its IUPAC name is trimethyl-[3-[methyl(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyl)amino]propyl]azanium.
| Compound Name | trimethyl-[3-[methyl(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyl)amino]propyl]azanium |
|---|---|
| PubChem CID | 139595257 |
| Molecular Formula | C12H18F11N2O2S+ |
| Molecular Weight | 463.33 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | trimethyl-[3-[methyl(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyl)amino]propyl]azanium |
| SMILES | CN(CCC[N+](C)(C)C)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H18F11N2O2S/c1-24(6-5-7-25(2,3)4)28(26,27)12(22,23)10(17,18)8(13,14)9(15,16)11(19,20)21/h5-7H2,1-4H3/q+1 |
| InChIKey | HLRMXWITAUKISG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|