About 2-bromo-2-(3,4-dibromocyclohexyl)ethanol
2-bromo-2-(3,4-dibromocyclohexyl)ethanol (PubChem CID 139595322) has the molecular formula C8H13Br3O
and a molecular weight of 364.90 g/mol. Its IUPAC name is 2-bromo-2-(3,4-dibromocyclohexyl)ethanol.
Molecular Properties
| Compound Name | 2-bromo-2-(3,4-dibromocyclohexyl)ethanol |
| PubChem CID | 139595322 |
| Molecular Formula | C8H13Br3O |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 361.85 |
| IUPAC Name | 2-bromo-2-(3,4-dibromocyclohexyl)ethanol |
| SMILES | OCC(Br)C1CCC(Br)C(Br)C1 |
| InChI | InChI=1S/C8H13Br3O/c9-6-2-1-5(3-7(6)10)8(11)4-12/h5-8,12H,1-4H2 |
| InChIKey | HVLYXALUPRXPEC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-2-(3,4-dibromocyclohexyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-2-(3,4-dibromocyclohexyl)ethanol?
The IUPAC name of 2-bromo-2-(3,4-dibromocyclohexyl)ethanol (CID 139595322) is 2-bromo-2-(3,4-dibromocyclohexyl)ethanol.
What is the SMILES notation for 2-bromo-2-(3,4-dibromocyclohexyl)ethanol?
The canonical SMILES for 2-bromo-2-(3,4-dibromocyclohexyl)ethanol is OCC(Br)C1CCC(Br)C(Br)C1.
What is the InChIKey of 2-bromo-2-(3,4-dibromocyclohexyl)ethanol?
The InChIKey is HVLYXALUPRXPEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13Br3O/c9-6-2-1-5(3-7(6)10)8(11)4-12/h5-8,12H,1-4H2.
What are the key properties of 2-bromo-2-(3,4-dibromocyclohexyl)ethanol?
2-bromo-2-(3,4-dibromocyclohexyl)ethanol has a molecular weight of 364.90 g/mol, XLogP of 3.07, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-2-(3,4-dibromocyclohexyl)ethanol is sourced from PubChem (CID 139595322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).