About amino(cyclohexyl)azanium sulfate
amino(cyclohexyl)azanium sulfate (PubChem CID 139595349) has the molecular formula C6H15N2O4S-
and a molecular weight of 211.26 g/mol. Its IUPAC name is amino(cyclohexyl)azanium sulfate.
Molecular Properties
| Compound Name | amino(cyclohexyl)azanium sulfate |
| PubChem CID | 139595349 |
| Molecular Formula | C6H15N2O4S- |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | amino(cyclohexyl)azanium sulfate |
| SMILES | N[NH2+]C1CCCCC1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C6H14N2.H2O4S/c7-8-6-4-2-1-3-5-6;1-5(2,3)4/h6,8H,1-5,7H2;(H2,1,2,3,4)/p-1 |
| InChIKey | HYGTVVBJPFJRKV-UHFFFAOYSA-M |
| XLogP | -1.58 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze amino(cyclohexyl)azanium sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino(cyclohexyl)azanium sulfate?
The IUPAC name of amino(cyclohexyl)azanium sulfate (CID 139595349) is amino(cyclohexyl)azanium sulfate.
What is the SMILES notation for amino(cyclohexyl)azanium sulfate?
The canonical SMILES for amino(cyclohexyl)azanium sulfate is N[NH2+]C1CCCCC1.O=S(=O)([O-])[O-].
What is the InChIKey of amino(cyclohexyl)azanium sulfate?
The InChIKey is HYGTVVBJPFJRKV-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H14N2.H2O4S/c7-8-6-4-2-1-3-5-6;1-5(2,3)4/h6,8H,1-5,7H2;(H2,1,2,3,4)/p-1.
What are the key properties of amino(cyclohexyl)azanium sulfate?
amino(cyclohexyl)azanium sulfate has a molecular weight of 211.26 g/mol, XLogP of -1.58, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino(cyclohexyl)azanium sulfate is sourced from PubChem (CID 139595349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).