C9H8F13NO5S2 — CID 139595388
3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonylamino)propane-1-sulfonic acid (PubChem CID 139595388) has the molecular formula C9H8F13NO5S2 and a molecular weight of 521.27 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonylamino)propane-1-sulfonic acid.
| Compound Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 139595388 |
| Molecular Formula | C9H8F13NO5S2 |
| Molecular Weight | 521.27 g/mol |
| Exact Mass | 520.96 |
| IUPAC Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonylamino)propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H8F13NO5S2/c10-4(11,6(14,15)8(18,19)20)5(12,13)7(16,17)9(21,22)30(27,28)23-2-1-3-29(24,25)26/h23H,1-3H2,(H,24,25,26) |
| InChIKey | IFYYQLFVVGOIPH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|