C6H8F7NO5S2 — CID 139595508
3-(1,1,2,2,3,3,3-heptafluoropropylsulfonylamino)propane-1-sulfonic acid (PubChem CID 139595508) has the molecular formula C6H8F7NO5S2 and a molecular weight of 371.25 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,3-heptafluoropropylsulfonylamino)propane-1-sulfonic acid.
| Compound Name | 3-(1,1,2,2,3,3,3-heptafluoropropylsulfonylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 139595508 |
| Molecular Formula | C6H8F7NO5S2 |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 370.97 |
| IUPAC Name | 3-(1,1,2,2,3,3,3-heptafluoropropylsulfonylamino)propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H8F7NO5S2/c7-4(8,5(9,10)11)6(12,13)21(18,19)14-2-1-3-20(15,16)17/h14H,1-3H2,(H,15,16,17) |
| InChIKey | IXWMYPLKYQPDCA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|