C14H18F15N2O2S+ — CID 139595510
trimethyl-[3-[methyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptylsulfonyl)amino]propyl]azanium (PubChem CID 139595510) has the molecular formula C14H18F15N2O2S+ and a molecular weight of 563.35 g/mol. Its IUPAC name is trimethyl-[3-[methyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptylsulfonyl)amino]propyl]azanium.
| Compound Name | trimethyl-[3-[methyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptylsulfonyl)amino]propyl]azanium |
|---|---|
| PubChem CID | 139595510 |
| Molecular Formula | C14H18F15N2O2S+ |
| Molecular Weight | 563.35 g/mol |
| Exact Mass | 563.08 |
| IUPAC Name | trimethyl-[3-[methyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptylsulfonyl)amino]propyl]azanium |
| SMILES | CN(CCC[N+](C)(C)C)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H18F15N2O2S/c1-30(6-5-7-31(2,3)4)34(32,33)14(28,29)12(23,24)10(19,20)8(15,16)9(17,18)11(21,22)13(25,26)27/h5-7H2,1-4H3/q+1 |
| InChIKey | IYBRQDTZWVOFKC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.35 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|