C25H32O13 — CID 139595592
methyl (2S,3R,4S)-4-[2-[2-(4-hydroxyphenyl)ethoxy]-2-oxoethyl]-3-(2-oxoethyl)-2-[(2S,3S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylate (PubChem CID 139595592) has the molecular formula C25H32O13 and a molecular weight of 540.52 g/mol. Its IUPAC name is methyl (2S,3R,4S)-4-[2-[2-(4-hydroxyphenyl)ethoxy]-2-oxoethyl]-3-(2-oxoethyl)-2-[(2S,3S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylate.
| Compound Name | methyl (2S,3R,4S)-4-[2-[2-(4-hydroxyphenyl)ethoxy]-2-oxoethyl]-3-(2-oxoethyl)-2-[(2S,3S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylate |
|---|---|
| PubChem CID | 139595592 |
| Molecular Formula | C25H32O13 |
| Molecular Weight | 540.52 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | methyl (2S,3R,4S)-4-[2-[2-(4-hydroxyphenyl)ethoxy]-2-oxoethyl]-3-(2-oxoethyl)-2-[(2S,3S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H](O[C@@H]2OC(CO)[C@@H](O)C(O)[C@@H]2O)[C@H](CC=O)[C@@H]1CC(=O)OCCc1ccc(O)cc1 |
| InChI | InChI=1S/C25H32O13/c1-34-23(33)17-12-36-24(38-25-22(32)21(31)20(30)18(11-27)37-25)15(6-8-26)16(17)10-19(29)35-9-7-13-2-4-14(28)5-3-13/h2-5,8,12,15-16,18,20-22,24-25,27-28,30-32H,6-7,9-11H2,1H3/t15-,16+,18?,20-,21?,22+,24+,25+/m1/s1 |
| InChIKey | JLTFCZQTUVJHDV-WOVVJLHFSA-N |
| XLogP | -1.08 |
| TPSA | 198.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.52 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|