About [3-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]urea
[3-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]urea (PubChem CID 139595717) has the molecular formula C10H7ClF6N2O3
and a molecular weight of 352.62 g/mol. Its IUPAC name is [3-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]urea.
Molecular Properties
| Compound Name | [3-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]urea |
| PubChem CID | 139595717 |
| Molecular Formula | C10H7ClF6N2O3 |
| Molecular Weight | 352.62 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | [3-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]urea |
| SMILES | NC(=O)Nc1ccc(OC(F)(F)C(F)OC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C10H7ClF6N2O3/c11-5-3-4(19-8(18)20)1-2-6(5)21-9(13,14)7(12)22-10(15,16)17/h1-3,7H,(H3,18,19,20) |
| InChIKey | KEVRTKYDPZZPIA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.62 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]urea?
The IUPAC name of [3-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]urea (CID 139595717) is [3-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]urea.
What is the SMILES notation for [3-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]urea?
The canonical SMILES for [3-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]urea is NC(=O)Nc1ccc(OC(F)(F)C(F)OC(F)(F)F)c(Cl)c1.
What is the InChIKey of [3-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]urea?
The InChIKey is KEVRTKYDPZZPIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7ClF6N2O3/c11-5-3-4(19-8(18)20)1-2-6(5)21-9(13,14)7(12)22-10(15,16)17/h1-3,7H,(H3,18,19,20).
What are the key properties of [3-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]urea?
[3-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]urea has a molecular weight of 352.62 g/mol, XLogP of 3.63, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]urea is sourced from PubChem (CID 139595717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).