C8H8F8O2 — CID 139595757
2,2,4,4,6,6,8,8-octafluorooctanoic acid (PubChem CID 139595757) has the molecular formula C8H8F8O2 and a molecular weight of 288.13 g/mol. Its IUPAC name is 2,2,4,4,6,6,8,8-octafluorooctanoic acid.
| Compound Name | 2,2,4,4,6,6,8,8-octafluorooctanoic acid |
|---|---|
| PubChem CID | 139595757 |
| Molecular Formula | C8H8F8O2 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2,2,4,4,6,6,8,8-octafluorooctanoic acid |
| SMILES | O=C(O)C(F)(F)CC(F)(F)CC(F)(F)CC(F)F |
| InChI | InChI=1S/C8H8F8O2/c9-4(10)1-6(11,12)2-7(13,14)3-8(15,16)5(17)18/h4H,1-3H2,(H,17,18) |
| InChIKey | KJEZYIAMIUWVSQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |