About 1-[4-(4-bromophenyl)phenyl]-3,5-diphenylpentane-1,5-diol
1-[4-(4-bromophenyl)phenyl]-3,5-diphenylpentane-1,5-diol (PubChem CID 139595937) has the molecular formula C29H27BrO2
and a molecular weight of 487.44 g/mol. Its IUPAC name is 1-[4-(4-bromophenyl)phenyl]-3,5-diphenylpentane-1,5-diol.
Molecular Properties
| Compound Name | 1-[4-(4-bromophenyl)phenyl]-3,5-diphenylpentane-1,5-diol |
| PubChem CID | 139595937 |
| Molecular Formula | C29H27BrO2 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 1-[4-(4-bromophenyl)phenyl]-3,5-diphenylpentane-1,5-diol |
| SMILES | OC(CC(CC(O)c1ccc(-c2ccc(Br)cc2)cc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H27BrO2/c30-27-17-15-23(16-18-27)22-11-13-25(14-12-22)29(32)20-26(21-7-3-1-4-8-21)19-28(31)24-9-5-2-6-10-24/h1-18,26,28-29,31-32H,19-20H2 |
| InChIKey | LNKXXKBBCPGRGY-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4-(4-bromophenyl)phenyl]-3,5-diphenylpentane-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-bromophenyl)phenyl]-3,5-diphenylpentane-1,5-diol?
The IUPAC name of 1-[4-(4-bromophenyl)phenyl]-3,5-diphenylpentane-1,5-diol (CID 139595937) is 1-[4-(4-bromophenyl)phenyl]-3,5-diphenylpentane-1,5-diol.
What is the SMILES notation for 1-[4-(4-bromophenyl)phenyl]-3,5-diphenylpentane-1,5-diol?
The canonical SMILES for 1-[4-(4-bromophenyl)phenyl]-3,5-diphenylpentane-1,5-diol is OC(CC(CC(O)c1ccc(-c2ccc(Br)cc2)cc1)c1ccccc1)c1ccccc1.
What is the InChIKey of 1-[4-(4-bromophenyl)phenyl]-3,5-diphenylpentane-1,5-diol?
The InChIKey is LNKXXKBBCPGRGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H27BrO2/c30-27-17-15-23(16-18-27)22-11-13-25(14-12-22)29(32)20-26(21-7-3-1-4-8-21)19-28(31)24-9-5-2-6-10-24/h1-18,26,28-29,31-32H,19-20H2.
What are the key properties of 1-[4-(4-bromophenyl)phenyl]-3,5-diphenylpentane-1,5-diol?
1-[4-(4-bromophenyl)phenyl]-3,5-diphenylpentane-1,5-diol has a molecular weight of 487.44 g/mol, XLogP of 7.45, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-bromophenyl)phenyl]-3,5-diphenylpentane-1,5-diol is sourced from PubChem (CID 139595937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).