C14H26F7N2O8S3+ — CID 139595961
3-[1,1,2,2,3,3,3-heptafluoropropylsulfonyl(3-sulfopropyl)amino]propyl-dimethyl-(3-sulfopropyl)azanium (PubChem CID 139595961) has the molecular formula C14H26F7N2O8S3+ and a molecular weight of 579.56 g/mol. Its IUPAC name is 3-[1,1,2,2,3,3,3-heptafluoropropylsulfonyl(3-sulfopropyl)amino]propyl-dimethyl-(3-sulfopropyl)azanium.
| Compound Name | 3-[1,1,2,2,3,3,3-heptafluoropropylsulfonyl(3-sulfopropyl)amino]propyl-dimethyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 139595961 |
| Molecular Formula | C14H26F7N2O8S3+ |
| Molecular Weight | 579.56 g/mol |
| Exact Mass | 579.07 |
| IUPAC Name | 3-[1,1,2,2,3,3,3-heptafluoropropylsulfonyl(3-sulfopropyl)amino]propyl-dimethyl-(3-sulfopropyl)azanium |
| SMILES | C[N+](C)(CCCN(CCCS(=O)(=O)O)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F)CCCS(=O)(=O)O |
| InChI | InChI=1S/C14H25F7N2O8S3/c1-23(2,9-5-11-33(27,28)29)8-3-6-22(7-4-10-32(24,25)26)34(30,31)14(20,21)12(15,16)13(17,18)19/h3-11H2,1-2H3,(H-,24,25,26,27,28,29)/p+1 |
| InChIKey | LRXMWUGTUSKIRI-UHFFFAOYSA-O |
| XLogP | 1.43 |
| TPSA | 146.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.56 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|