C8H13F7N2O2S — CID 139596046
N-[3-(dimethylamino)propyl]-1,1,2,2,3,3,3-heptafluoropropane-1-sulfonamide (PubChem CID 139596046) has the molecular formula C8H13F7N2O2S and a molecular weight of 334.26 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-1,1,2,2,3,3,3-heptafluoropropane-1-sulfonamide.
| Compound Name | N-[3-(dimethylamino)propyl]-1,1,2,2,3,3,3-heptafluoropropane-1-sulfonamide |
|---|---|
| PubChem CID | 139596046 |
| Molecular Formula | C8H13F7N2O2S |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-1,1,2,2,3,3,3-heptafluoropropane-1-sulfonamide |
| SMILES | CN(C)CCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H13F7N2O2S/c1-17(2)5-3-4-16-20(18,19)8(14,15)6(9,10)7(11,12)13/h16H,3-5H2,1-2H3 |
| InChIKey | MHWKVXOZNXDWGM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|