C10HF17O2 — CID 139596126
(E)-2,2,3,3,4,4,5,5,6,6,7,8,9,9,10,10,10-heptadecafluorodec-7-enoic acid (PubChem CID 139596126) has the molecular formula C10HF17O2 and a molecular weight of 476.08 g/mol. Its IUPAC name is (E)-2,2,3,3,4,4,5,5,6,6,7,8,9,9,10,10,10-heptadecafluorodec-7-enoic acid.
| Compound Name | (E)-2,2,3,3,4,4,5,5,6,6,7,8,9,9,10,10,10-heptadecafluorodec-7-enoic acid |
|---|---|
| PubChem CID | 139596126 |
| Molecular Formula | C10HF17O2 |
| Molecular Weight | 476.08 g/mol |
| Exact Mass | 475.97 |
| IUPAC Name | (E)-2,2,3,3,4,4,5,5,6,6,7,8,9,9,10,10,10-heptadecafluorodec-7-enoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)/C(F)=C(\F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10HF17O2/c11-1(2(12)5(15,16)10(25,26)27)4(13,14)7(19,20)9(23,24)8(21,22)6(17,18)3(28)29/h(H,28,29)/b2-1+ |
| InChIKey | MSJUPIYQOIUUBT-OWOJBTEDSA-N |
| XLogP | 5.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.08 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|