About 2,7-dimethoxy-4,5-diphenyl-9H-carbazole
2,7-dimethoxy-4,5-diphenyl-9H-carbazole (PubChem CID 139596138) has the molecular formula C26H21NO2
and a molecular weight of 379.46 g/mol. Its IUPAC name is 2,7-dimethoxy-4,5-diphenyl-9H-carbazole.
Molecular Properties
| Compound Name | 2,7-dimethoxy-4,5-diphenyl-9H-carbazole |
| PubChem CID | 139596138 |
| Molecular Formula | C26H21NO2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2,7-dimethoxy-4,5-diphenyl-9H-carbazole |
| SMILES | COc1cc(-c2ccccc2)c2c(c1)[nH]c1cc(OC)cc(-c3ccccc3)c12 |
| InChI | InChI=1S/C26H21NO2/c1-28-19-13-21(17-9-5-3-6-10-17)25-23(15-19)27-24-16-20(29-2)14-22(26(24)25)18-11-7-4-8-12-18/h3-16,27H,1-2H3 |
| InChIKey | MTTFAQQFVMJALB-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,7-dimethoxy-4,5-diphenyl-9H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethoxy-4,5-diphenyl-9H-carbazole?
The IUPAC name of 2,7-dimethoxy-4,5-diphenyl-9H-carbazole (CID 139596138) is 2,7-dimethoxy-4,5-diphenyl-9H-carbazole.
What is the SMILES notation for 2,7-dimethoxy-4,5-diphenyl-9H-carbazole?
The canonical SMILES for 2,7-dimethoxy-4,5-diphenyl-9H-carbazole is COc1cc(-c2ccccc2)c2c(c1)[nH]c1cc(OC)cc(-c3ccccc3)c12.
What is the InChIKey of 2,7-dimethoxy-4,5-diphenyl-9H-carbazole?
The InChIKey is MTTFAQQFVMJALB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21NO2/c1-28-19-13-21(17-9-5-3-6-10-17)25-23(15-19)27-24-16-20(29-2)14-22(26(24)25)18-11-7-4-8-12-18/h3-16,27H,1-2H3.
What are the key properties of 2,7-dimethoxy-4,5-diphenyl-9H-carbazole?
2,7-dimethoxy-4,5-diphenyl-9H-carbazole has a molecular weight of 379.46 g/mol, XLogP of 6.67, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethoxy-4,5-diphenyl-9H-carbazole is sourced from PubChem (CID 139596138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).