C7H8F9NO5S2 — CID 139596628
3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)propane-1-sulfonic acid (PubChem CID 139596628) has the molecular formula C7H8F9NO5S2 and a molecular weight of 421.26 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)propane-1-sulfonic acid.
| Compound Name | 3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 139596628 |
| Molecular Formula | C7H8F9NO5S2 |
| Molecular Weight | 421.26 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | 3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H8F9NO5S2/c8-4(9,6(12,13)14)5(10,11)7(15,16)24(21,22)17-2-1-3-23(18,19)20/h17H,1-3H2,(H,18,19,20) |
| InChIKey | PNGHFDKTDSVOEV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|