About N-(3,5-dichlorophenyl)-2,5-dioxoimidazolidine-1-carboxamide
N-(3,5-dichlorophenyl)-2,5-dioxoimidazolidine-1-carboxamide (PubChem CID 139596644) has the molecular formula C10H7Cl2N3O3
and a molecular weight of 288.09 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2,5-dioxoimidazolidine-1-carboxamide.
Molecular Properties
| Compound Name | N-(3,5-dichlorophenyl)-2,5-dioxoimidazolidine-1-carboxamide |
| PubChem CID | 139596644 |
| Molecular Formula | C10H7Cl2N3O3 |
| Molecular Weight | 288.09 g/mol |
| Exact Mass | 286.99 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2,5-dioxoimidazolidine-1-carboxamide |
| SMILES | O=C1CNC(=O)N1C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H7Cl2N3O3/c11-5-1-6(12)3-7(2-5)14-10(18)15-8(16)4-13-9(15)17/h1-3H,4H2,(H,13,17)(H,14,18) |
| InChIKey | PPSVJAKXLXPIOG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.09 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze N-(3,5-dichlorophenyl)-2,5-dioxoimidazolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dichlorophenyl)-2,5-dioxoimidazolidine-1-carboxamide?
The IUPAC name of N-(3,5-dichlorophenyl)-2,5-dioxoimidazolidine-1-carboxamide (CID 139596644) is N-(3,5-dichlorophenyl)-2,5-dioxoimidazolidine-1-carboxamide.
What is the SMILES notation for N-(3,5-dichlorophenyl)-2,5-dioxoimidazolidine-1-carboxamide?
The canonical SMILES for N-(3,5-dichlorophenyl)-2,5-dioxoimidazolidine-1-carboxamide is O=C1CNC(=O)N1C(=O)Nc1cc(Cl)cc(Cl)c1.
What is the InChIKey of N-(3,5-dichlorophenyl)-2,5-dioxoimidazolidine-1-carboxamide?
The InChIKey is PPSVJAKXLXPIOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl2N3O3/c11-5-1-6(12)3-7(2-5)14-10(18)15-8(16)4-13-9(15)17/h1-3H,4H2,(H,13,17)(H,14,18).
What are the key properties of N-(3,5-dichlorophenyl)-2,5-dioxoimidazolidine-1-carboxamide?
N-(3,5-dichlorophenyl)-2,5-dioxoimidazolidine-1-carboxamide has a molecular weight of 288.09 g/mol, XLogP of 2.08, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dichlorophenyl)-2,5-dioxoimidazolidine-1-carboxamide is sourced from PubChem (CID 139596644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).