C21H29N5O7 — CID 139596689
tert-butyl N-[2-[(2S)-3-[(2S)-2-anilinopropanoyl]-2-carbamoyl-4-nitropyrrolidin-1-yl]-2-oxoethyl]carbamate (PubChem CID 139596689) has the molecular formula C21H29N5O7 and a molecular weight of 463.49 g/mol. Its IUPAC name is tert-butyl N-[2-[(2S)-3-[(2S)-2-anilinopropanoyl]-2-carbamoyl-4-nitropyrrolidin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2S)-3-[(2S)-2-anilinopropanoyl]-2-carbamoyl-4-nitropyrrolidin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 139596689 |
| Molecular Formula | C21H29N5O7 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | tert-butyl N-[2-[(2S)-3-[(2S)-2-anilinopropanoyl]-2-carbamoyl-4-nitropyrrolidin-1-yl]-2-oxoethyl]carbamate |
| SMILES | C[C@H](Nc1ccccc1)C(=O)C1C([N+](=O)[O-])CN(C(=O)CNC(=O)OC(C)(C)C)[C@@H]1C(N)=O |
| InChI | InChI=1S/C21H29N5O7/c1-12(24-13-8-6-5-7-9-13)18(28)16-14(26(31)32)11-25(17(16)19(22)29)15(27)10-23-20(30)33-21(2,3)4/h5-9,12,14,16-17,24H,10-11H2,1-4H3,(H2,22,29)(H,23,30)/t12-,14?,16?,17-/m0/s1 |
| InChIKey | PVILUSKMXISZKF-XNPDXQRHSA-N |
| XLogP | 0.54 |
| TPSA | 173.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|