C12H24O — CID 139596731
2,2,4,6,6-pentamethylhept-4-en-3-ol (PubChem CID 139596731) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is 2,2,4,6,6-pentamethylhept-4-en-3-ol.
| Compound Name | 2,2,4,6,6-pentamethylhept-4-en-3-ol |
|---|---|
| PubChem CID | 139596731 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | 2,2,4,6,6-pentamethylhept-4-en-3-ol |
| SMILES | CC(=CC(C)(C)C)C(O)C(C)(C)C |
| InChI | InChI=1S/C12H24O/c1-9(8-11(2,3)4)10(13)12(5,6)7/h8,10,13H,1-7H3 |
| InChIKey | QBSVQCVLZODXFY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|