C18H19F21NOS+ — CID 139596842
[3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecylsulfanyl)-2-hydroxypropyl]-trimethylazanium (PubChem CID 139596842) has the molecular formula C18H19F21NOS+ and a molecular weight of 696.38 g/mol. Its IUPAC name is [3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecylsulfanyl)-2-hydroxypropyl]-trimethylazanium.
| Compound Name | [3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecylsulfanyl)-2-hydroxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 139596842 |
| Molecular Formula | C18H19F21NOS+ |
| Molecular Weight | 696.38 g/mol |
| Exact Mass | 696.08 |
| IUPAC Name | [3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecylsulfanyl)-2-hydroxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(O)CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H19F21NOS/c1-40(2,3)6-8(41)7-42-5-4-9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)15(31,32)16(33,34)17(35,36)18(37,38)39/h8,41H,4-7H2,1-3H3/q+1 |
| InChIKey | QVLDZGBSRSYNFI-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.38 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|