C14H14F14O2 — CID 139596906
2,2,4,4,6,6,8,8,10,10,12,12,14,14-tetradecafluorotetradecanoic acid (PubChem CID 139596906) has the molecular formula C14H14F14O2 and a molecular weight of 480.24 g/mol. Its IUPAC name is 2,2,4,4,6,6,8,8,10,10,12,12,14,14-tetradecafluorotetradecanoic acid.
| Compound Name | 2,2,4,4,6,6,8,8,10,10,12,12,14,14-tetradecafluorotetradecanoic acid |
|---|---|
| PubChem CID | 139596906 |
| Molecular Formula | C14H14F14O2 |
| Molecular Weight | 480.24 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 2,2,4,4,6,6,8,8,10,10,12,12,14,14-tetradecafluorotetradecanoic acid |
| SMILES | O=C(O)C(F)(F)CC(F)(F)CC(F)(F)CC(F)(F)CC(F)(F)CC(F)(F)CC(F)F |
| InChI | InChI=1S/C14H14F14O2/c15-7(16)1-9(17,18)2-10(19,20)3-11(21,22)4-12(23,24)5-13(25,26)6-14(27,28)8(29)30/h7H,1-6H2,(H,29,30) |
| InChIKey | RFPMTAFFMFIXAL-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.24 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |