C11H13F11N2O — CID 139596925
N-[3-(dimethylamino)propyl]-2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanamide (PubChem CID 139596925) has the molecular formula C11H13F11N2O and a molecular weight of 398.22 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanamide |
|---|---|
| PubChem CID | 139596925 |
| Molecular Formula | C11H13F11N2O |
| Molecular Weight | 398.22 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanamide |
| SMILES | CN(C)CCCNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H13F11N2O/c1-24(2)5-3-4-23-6(25)7(12,13)8(14,15)9(16,17)10(18,19)11(20,21)22/h3-5H2,1-2H3,(H,23,25) |
| InChIKey | RKCBASOCGZNLGO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|