About disodium;4-hydroxy-5-methoxy-1H-pyrimidin-6-one
disodium;4-hydroxy-5-methoxy-1H-pyrimidin-6-one (PubChem CID 139596980) has the molecular formula C5H6N2Na2O3+2
and a molecular weight of 188.09 g/mol. Its IUPAC name is disodium;4-hydroxy-5-methoxy-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | disodium;4-hydroxy-5-methoxy-1H-pyrimidin-6-one |
| PubChem CID | 139596980 |
| Molecular Formula | C5H6N2Na2O3+2 |
| Molecular Weight | 188.09 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | disodium;4-hydroxy-5-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1c(O)nc[nH]c1=O.[Na+].[Na+] |
| InChI | InChI=1S/C5H6N2O3.2Na/c1-10-3-4(8)6-2-7-5(3)9;;/h2H,1H3,(H2,6,7,8,9);;/q;2*+1 |
| InChIKey | RUMJWTQIKUQSCT-UHFFFAOYSA-N |
| XLogP | -6.51 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.09 |
| LogP ≤ 5 | -6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze disodium;4-hydroxy-5-methoxy-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;4-hydroxy-5-methoxy-1H-pyrimidin-6-one?
The IUPAC name of disodium;4-hydroxy-5-methoxy-1H-pyrimidin-6-one (CID 139596980) is disodium;4-hydroxy-5-methoxy-1H-pyrimidin-6-one.
What is the SMILES notation for disodium;4-hydroxy-5-methoxy-1H-pyrimidin-6-one?
The canonical SMILES for disodium;4-hydroxy-5-methoxy-1H-pyrimidin-6-one is COc1c(O)nc[nH]c1=O.[Na+].[Na+].
What is the InChIKey of disodium;4-hydroxy-5-methoxy-1H-pyrimidin-6-one?
The InChIKey is RUMJWTQIKUQSCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O3.2Na/c1-10-3-4(8)6-2-7-5(3)9;;/h2H,1H3,(H2,6,7,8,9);;/q;2*+1.
What are the key properties of disodium;4-hydroxy-5-methoxy-1H-pyrimidin-6-one?
disodium;4-hydroxy-5-methoxy-1H-pyrimidin-6-one has a molecular weight of 188.09 g/mol, XLogP of -6.51, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;4-hydroxy-5-methoxy-1H-pyrimidin-6-one is sourced from PubChem (CID 139596980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).