C14H18O5S — CID 139597058
2-(4-ethyl-6-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl)acetic acid (PubChem CID 139597058) has the molecular formula C14H18O5S and a molecular weight of 298.36 g/mol. Its IUPAC name is 2-(4-ethyl-6-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl)acetic acid.
| Compound Name | 2-(4-ethyl-6-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl)acetic acid |
|---|---|
| PubChem CID | 139597058 |
| Molecular Formula | C14H18O5S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-(4-ethyl-6-sulfo-1,2,3,4-tetrahydronaphthalen-1-yl)acetic acid |
| SMILES | CCC1CCC(CC(=O)O)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C14H18O5S/c1-2-9-3-4-10(7-14(15)16)12-6-5-11(8-13(9)12)20(17,18)19/h5-6,8-10H,2-4,7H2,1H3,(H,15,16)(H,17,18,19) |
| InChIKey | SFYYMRZZQXITOX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|